C36H43NO4 — CID 90168252
3-[4-[N-(3,4-dimethylphenyl)-4-[3-[(E)-pent-2-enoyl]oxypropyl]anilino]phenyl]propyl (E)-pent-2-enoate (PubChem CID 90168252) has the molecular formula C36H43NO4 and a molecular weight of 553.74 g/mol. Its IUPAC name is 3-[4-[N-(3,4-dimethylphenyl)-4-[3-[(E)-pent-2-enoyl]oxypropyl]anilino]phenyl]propyl (E)-pent-2-enoate.
| Compound Name | 3-[4-[N-(3,4-dimethylphenyl)-4-[3-[(E)-pent-2-enoyl]oxypropyl]anilino]phenyl]propyl (E)-pent-2-enoate |
|---|---|
| PubChem CID | 90168252 |
| Molecular Formula | C36H43NO4 |
| Molecular Weight | 553.74 g/mol |
| Exact Mass | 553.32 |
| IUPAC Name | 3-[4-[N-(3,4-dimethylphenyl)-4-[3-[(E)-pent-2-enoyl]oxypropyl]anilino]phenyl]propyl (E)-pent-2-enoate |
| SMILES | CC/C=C/C(=O)OCCCc1ccc(N(c2ccc(CCCOC(=O)/C=C/CC)cc2)c2ccc(C)c(C)c2)cc1 |
| InChI | InChI=1S/C36H43NO4/c1-5-7-13-35(38)40-25-9-11-30-16-21-32(22-17-30)37(34-20-15-28(3)29(4)27-34)33-23-18-31(19-24-33)12-10-26-41-36(39)14-8-6-2/h7-8,13-24,27H,5-6,9-12,25-26H2,1-4H3/b13-7+,14-8+ |
| InChIKey | BBBVLEHMOHWRRN-FNCQTZNRSA-N |
| XLogP | 8.66 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.74 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|