C36H43NO4 — CID 123385636
4-[4-[4-(4-but-2-enoyloxybutyl)-N-(3,4-dimethylphenyl)anilino]phenyl]butyl but-2-enoate (PubChem CID 123385636) has the molecular formula C36H43NO4 and a molecular weight of 553.74 g/mol. Its IUPAC name is 4-[4-[4-(4-but-2-enoyloxybutyl)-N-(3,4-dimethylphenyl)anilino]phenyl]butyl but-2-enoate.
| Compound Name | 4-[4-[4-(4-but-2-enoyloxybutyl)-N-(3,4-dimethylphenyl)anilino]phenyl]butyl but-2-enoate |
|---|---|
| PubChem CID | 123385636 |
| Molecular Formula | C36H43NO4 |
| Molecular Weight | 553.74 g/mol |
| Exact Mass | 553.32 |
| IUPAC Name | 4-[4-[4-(4-but-2-enoyloxybutyl)-N-(3,4-dimethylphenyl)anilino]phenyl]butyl but-2-enoate |
| SMILES | CC=CC(=O)OCCCCc1ccc(N(c2ccc(CCCCOC(=O)C=CC)cc2)c2ccc(C)c(C)c2)cc1 |
| InChI | InChI=1S/C36H43NO4/c1-5-11-35(38)40-25-9-7-13-30-16-21-32(22-17-30)37(34-20-15-28(3)29(4)27-34)33-23-18-31(19-24-33)14-8-10-26-41-36(39)12-6-2/h5-6,11-12,15-24,27H,7-10,13-14,25-26H2,1-4H3 |
| InChIKey | HEXYPZKZGIYIQX-UHFFFAOYSA-N |
| XLogP | 8.66 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.74 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|