C31H33NO4 — CID 139538030
2-[4-[N-(3,4-dimethylphenyl)-4-(2-prop-2-enoyloxyethyl)anilino]phenyl]ethyl 2-methylprop-2-enoate (PubChem CID 139538030) has the molecular formula C31H33NO4 and a molecular weight of 483.61 g/mol. Its IUPAC name is 2-[4-[N-(3,4-dimethylphenyl)-4-(2-prop-2-enoyloxyethyl)anilino]phenyl]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[4-[N-(3,4-dimethylphenyl)-4-(2-prop-2-enoyloxyethyl)anilino]phenyl]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 139538030 |
| Molecular Formula | C31H33NO4 |
| Molecular Weight | 483.61 g/mol |
| Exact Mass | 483.24 |
| IUPAC Name | 2-[4-[N-(3,4-dimethylphenyl)-4-(2-prop-2-enoyloxyethyl)anilino]phenyl]ethyl 2-methylprop-2-enoate |
| SMILES | C=CC(=O)OCCc1ccc(N(c2ccc(CCOC(=O)C(=C)C)cc2)c2ccc(C)c(C)c2)cc1 |
| InChI | InChI=1S/C31H33NO4/c1-6-30(33)35-19-17-25-8-13-27(14-9-25)32(29-12-7-23(4)24(5)21-29)28-15-10-26(11-16-28)18-20-36-31(34)22(2)3/h6-16,21H,1-2,17-20H2,3-5H3 |
| InChIKey | XKXJUSCWGABOGL-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.61 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|