C15H21NO2 — CID 68773183
2-[4-(diethylamino)phenyl]ethyl prop-2-enoate (PubChem CID 68773183) has the molecular formula C15H21NO2 and a molecular weight of 247.34 g/mol. Its IUPAC name is 2-[4-(diethylamino)phenyl]ethyl prop-2-enoate.
| Compound Name | 2-[4-(diethylamino)phenyl]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 68773183 |
| Molecular Formula | C15H21NO2 |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.16 |
| IUPAC Name | 2-[4-(diethylamino)phenyl]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCc1ccc(N(CC)CC)cc1 |
| InChI | InChI=1S/C15H21NO2/c1-4-15(17)18-12-11-13-7-9-14(10-8-13)16(5-2)6-3/h4,7-10H,1,5-6,11-12H2,2-3H3 |
| InChIKey | QXKMUGZDCQQWCA-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|