About 2-(4-benzylphenyl)ethyl prop-2-enoate
2-(4-benzylphenyl)ethyl prop-2-enoate (PubChem CID 18316835) has the molecular formula C18H18O2
and a molecular weight of 266.34 g/mol. Its IUPAC name is 2-(4-benzylphenyl)ethyl prop-2-enoate.
Molecular Properties
| Compound Name | 2-(4-benzylphenyl)ethyl prop-2-enoate |
| PubChem CID | 18316835 |
| Molecular Formula | C18H18O2 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | 2-(4-benzylphenyl)ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCc1ccc(Cc2ccccc2)cc1 |
| InChI | InChI=1S/C18H18O2/c1-2-18(19)20-13-12-15-8-10-17(11-9-15)14-16-6-4-3-5-7-16/h2-11H,1,12-14H2 |
| InChIKey | RXJDBBGJXISASI-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-benzylphenyl)ethyl prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-benzylphenyl)ethyl prop-2-enoate?
The IUPAC name of 2-(4-benzylphenyl)ethyl prop-2-enoate (CID 18316835) is 2-(4-benzylphenyl)ethyl prop-2-enoate.
What is the SMILES notation for 2-(4-benzylphenyl)ethyl prop-2-enoate?
The canonical SMILES for 2-(4-benzylphenyl)ethyl prop-2-enoate is C=CC(=O)OCCc1ccc(Cc2ccccc2)cc1.
What is the InChIKey of 2-(4-benzylphenyl)ethyl prop-2-enoate?
The InChIKey is RXJDBBGJXISASI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18O2/c1-2-18(19)20-13-12-15-8-10-17(11-9-15)14-16-6-4-3-5-7-16/h2-11H,1,12-14H2.
What are the key properties of 2-(4-benzylphenyl)ethyl prop-2-enoate?
2-(4-benzylphenyl)ethyl prop-2-enoate has a molecular weight of 266.34 g/mol, XLogP of 3.55, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-benzylphenyl)ethyl prop-2-enoate is sourced from PubChem (CID 18316835), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).