C34H33NO2 — CID 170007475
2-[4-(N-(9,9-dimethylfluoren-2-yl)-3,4-dimethylanilino)phenyl]ethyl prop-2-enoate (PubChem CID 170007475) has the molecular formula C34H33NO2 and a molecular weight of 487.64 g/mol. Its IUPAC name is 2-[4-(N-(9,9-dimethylfluoren-2-yl)-3,4-dimethylanilino)phenyl]ethyl prop-2-enoate.
| Compound Name | 2-[4-(N-(9,9-dimethylfluoren-2-yl)-3,4-dimethylanilino)phenyl]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 170007475 |
| Molecular Formula | C34H33NO2 |
| Molecular Weight | 487.64 g/mol |
| Exact Mass | 487.25 |
| IUPAC Name | 2-[4-(N-(9,9-dimethylfluoren-2-yl)-3,4-dimethylanilino)phenyl]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCc1ccc(N(c2ccc(C)c(C)c2)c2ccc3c(c2)C(C)(C)c2ccccc2-3)cc1 |
| InChI | InChI=1S/C34H33NO2/c1-6-33(36)37-20-19-25-12-15-26(16-13-25)35(27-14-11-23(2)24(3)21-27)28-17-18-30-29-9-7-8-10-31(29)34(4,5)32(30)22-28/h6-18,21-22H,1,19-20H2,2-5H3 |
| InChIKey | NZIATERAPXGVIL-UHFFFAOYSA-N |
| XLogP | 8.35 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.64 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|