C37H35NO4 — CID 89094804
1-[4-[N-(9,9-dimethylfluoren-2-yl)-4-(1-prop-2-enoyloxyethyl)anilino]phenyl]ethyl prop-2-enoate (PubChem CID 89094804) has the molecular formula C37H35NO4 and a molecular weight of 557.69 g/mol. Its IUPAC name is 1-[4-[N-(9,9-dimethylfluoren-2-yl)-4-(1-prop-2-enoyloxyethyl)anilino]phenyl]ethyl prop-2-enoate.
| Compound Name | 1-[4-[N-(9,9-dimethylfluoren-2-yl)-4-(1-prop-2-enoyloxyethyl)anilino]phenyl]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 89094804 |
| Molecular Formula | C37H35NO4 |
| Molecular Weight | 557.69 g/mol |
| Exact Mass | 557.26 |
| IUPAC Name | 1-[4-[N-(9,9-dimethylfluoren-2-yl)-4-(1-prop-2-enoyloxyethyl)anilino]phenyl]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OC(C)c1ccc(N(c2ccc(C(C)OC(=O)C=C)cc2)c2ccc3c(c2)C(C)(C)c2ccccc2-3)cc1 |
| InChI | InChI=1S/C37H35NO4/c1-7-35(39)41-24(3)26-13-17-28(18-14-26)38(29-19-15-27(16-20-29)25(4)42-36(40)8-2)30-21-22-32-31-11-9-10-12-33(31)37(5,6)34(32)23-30/h7-25H,1-2H2,3-6H3 |
| InChIKey | OEJVLKSWVSQXGP-UHFFFAOYSA-N |
| XLogP | 9.04 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.69 |
| LogP ≤ 5 | 9.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|