C29H27NO2 — CID 20734434
N,N-bis(4-methoxyphenyl)-9,9-dimethylfluoren-2-amine (PubChem CID 20734434) has the molecular formula C29H27NO2 and a molecular weight of 421.54 g/mol. Its IUPAC name is N,N-bis(4-methoxyphenyl)-9,9-dimethylfluoren-2-amine.
| Compound Name | N,N-bis(4-methoxyphenyl)-9,9-dimethylfluoren-2-amine |
|---|---|
| PubChem CID | 20734434 |
| Molecular Formula | C29H27NO2 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.20 |
| IUPAC Name | N,N-bis(4-methoxyphenyl)-9,9-dimethylfluoren-2-amine |
| SMILES | COc1ccc(N(c2ccc(OC)cc2)c2ccc3c(c2)C(C)(C)c2ccccc2-3)cc1 |
| InChI | InChI=1S/C29H27NO2/c1-29(2)27-8-6-5-7-25(27)26-18-13-22(19-28(26)29)30(20-9-14-23(31-3)15-10-20)21-11-16-24(32-4)17-12-21/h5-19H,1-4H3 |
| InChIKey | ZTFCMVAPUSYAAR-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |