C27H24BNO3 — CID 142737900
[4-(N-(9,9-dimethylfluoren-2-yl)anilino)phenoxy]boronic acid (PubChem CID 142737900) has the molecular formula C27H24BNO3 and a molecular weight of 421.31 g/mol. Its IUPAC name is [4-(N-(9,9-dimethylfluoren-2-yl)anilino)phenoxy]boronic acid.
| Compound Name | [4-(N-(9,9-dimethylfluoren-2-yl)anilino)phenoxy]boronic acid |
|---|---|
| PubChem CID | 142737900 |
| Molecular Formula | C27H24BNO3 |
| Molecular Weight | 421.31 g/mol |
| Exact Mass | 421.18 |
| IUPAC Name | [4-(N-(9,9-dimethylfluoren-2-yl)anilino)phenoxy]boronic acid |
| SMILES | CC1(C)c2ccccc2-c2ccc(N(c3ccccc3)c3ccc(OB(O)O)cc3)cc21 |
| InChI | InChI=1S/C27H24BNO3/c1-27(2)25-11-7-6-10-23(25)24-17-14-21(18-26(24)27)29(19-8-4-3-5-9-19)20-12-15-22(16-13-20)32-28(30)31/h3-18,30-31H,1-2H3 |
| InChIKey | IDMXJSODQFLZLB-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.31 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|