C35H32BNO2 — CID 144631341
[4-(N-(9,9-dimethylfluoren-2-yl)-4-phenylanilino)phenyl]boronic acid;ethene (PubChem CID 144631341) has the molecular formula C35H32BNO2 and a molecular weight of 509.46 g/mol. Its IUPAC name is [4-(N-(9,9-dimethylfluoren-2-yl)-4-phenylanilino)phenyl]boronic acid;ethene.
| Compound Name | [4-(N-(9,9-dimethylfluoren-2-yl)-4-phenylanilino)phenyl]boronic acid;ethene |
|---|---|
| PubChem CID | 144631341 |
| Molecular Formula | C35H32BNO2 |
| Molecular Weight | 509.46 g/mol |
| Exact Mass | 509.25 |
| IUPAC Name | [4-(N-(9,9-dimethylfluoren-2-yl)-4-phenylanilino)phenyl]boronic acid;ethene |
| SMILES | C=C.CC1(C)c2ccccc2-c2ccc(N(c3ccc(B(O)O)cc3)c3ccc(-c4ccccc4)cc3)cc21 |
| InChI | InChI=1S/C33H28BNO2.C2H4/c1-33(2)31-11-7-6-10-29(31)30-21-20-28(22-32(30)33)35(27-18-14-25(15-19-27)34(36)37)26-16-12-24(13-17-26)23-8-4-3-5-9-23;1-2/h3-22,36-37H,1-2H3;1-2H2 |
| InChIKey | XRLIJQMSALDXGS-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.46 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|