C21H19BO2 — CID 59691054
[4-(9,9-dimethylfluoren-2-yl)phenyl]boronic acid (PubChem CID 59691054) has the molecular formula C21H19BO2 and a molecular weight of 314.19 g/mol. Its IUPAC name is [4-(9,9-dimethylfluoren-2-yl)phenyl]boronic acid.
| Compound Name | [4-(9,9-dimethylfluoren-2-yl)phenyl]boronic acid |
|---|---|
| PubChem CID | 59691054 |
| Molecular Formula | C21H19BO2 |
| Molecular Weight | 314.19 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | [4-(9,9-dimethylfluoren-2-yl)phenyl]boronic acid |
| SMILES | CC1(C)c2ccccc2-c2ccc(-c3ccc(B(O)O)cc3)cc21 |
| InChI | InChI=1S/C21H19BO2/c1-21(2)19-6-4-3-5-17(19)18-12-9-15(13-20(18)21)14-7-10-16(11-8-14)22(23)24/h3-13,23-24H,1-2H3 |
| InChIKey | FSMWZBLRBKQMOS-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.19 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|