C21H17B — CID 143619792
CID 143619792 (PubChem CID 143619792) has the molecular formula C21H17B and a molecular weight of 280.18 g/mol.
| Compound Name | CID 143619792 |
|---|---|
| PubChem CID | 143619792 |
| Molecular Formula | C21H17B |
| Molecular Weight | 280.18 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | — |
| SMILES | [B]c1ccc(-c2ccc3c(c2)C(C)(C)c2ccccc2-3)cc1 |
| InChI | InChI=1S/C21H17B/c1-21(2)19-6-4-3-5-17(19)18-12-9-15(13-20(18)21)14-7-10-16(22)11-8-14/h3-13H,1-2H3 |
| InChIKey | SARGPDATRNOIIT-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.18 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|