C31H28 — CID 144585061
6,6,12,12-tetramethyl-2-(4-methylphenyl)indeno[1,2-b]fluorene (PubChem CID 144585061) has the molecular formula C31H28 and a molecular weight of 400.57 g/mol. Its IUPAC name is 6,6,12,12-tetramethyl-2-(4-methylphenyl)indeno[1,2-b]fluorene.
| Compound Name | 6,6,12,12-tetramethyl-2-(4-methylphenyl)indeno[1,2-b]fluorene |
|---|---|
| PubChem CID | 144585061 |
| Molecular Formula | C31H28 |
| Molecular Weight | 400.57 g/mol |
| Exact Mass | 400.22 |
| IUPAC Name | 6,6,12,12-tetramethyl-2-(4-methylphenyl)indeno[1,2-b]fluorene |
| SMILES | Cc1ccc(-c2ccc3c(c2)C(C)(C)c2cc4c(cc2-3)C(C)(C)c2ccccc2-4)cc1 |
| InChI | InChI=1S/C31H28/c1-19-10-12-20(13-11-19)21-14-15-23-25-18-28-24(17-29(25)31(4,5)27(23)16-21)22-8-6-7-9-26(22)30(28,2)3/h6-18H,1-5H3 |
| InChIKey | SMPPIMKNKVUSRQ-UHFFFAOYSA-N |
| XLogP | 8.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.57 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |