C41H40 — CID 59782412
2-(4-tert-butylphenyl)-9,9-dimethyl-7-(3,9,9-trimethylfluoren-2-yl)fluorene (PubChem CID 59782412) has the molecular formula C41H40 and a molecular weight of 532.77 g/mol. Its IUPAC name is 2-(4-tert-butylphenyl)-9,9-dimethyl-7-(3,9,9-trimethylfluoren-2-yl)fluorene.
| Compound Name | 2-(4-tert-butylphenyl)-9,9-dimethyl-7-(3,9,9-trimethylfluoren-2-yl)fluorene |
|---|---|
| PubChem CID | 59782412 |
| Molecular Formula | C41H40 |
| Molecular Weight | 532.77 g/mol |
| Exact Mass | 532.31 |
| IUPAC Name | 2-(4-tert-butylphenyl)-9,9-dimethyl-7-(3,9,9-trimethylfluoren-2-yl)fluorene |
| SMILES | Cc1cc2c(cc1-c1ccc3c(c1)C(C)(C)c1cc(-c4ccc(C(C)(C)C)cc4)ccc1-3)C(C)(C)c1ccccc1-2 |
| InChI | InChI=1S/C41H40/c1-25-21-34-30-11-9-10-12-35(30)40(5,6)38(34)24-33(25)28-16-20-32-31-19-15-27(22-36(31)41(7,8)37(32)23-28)26-13-17-29(18-14-26)39(2,3)4/h9-24H,1-8H3 |
| InChIKey | DMLGUYAOHCMHGN-UHFFFAOYSA-N |
| XLogP | 11.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.77 |
| LogP ≤ 5 | 11.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |