C56H55N — CID 58389668
N,N-bis(4-tert-butylphenyl)-3,5-bis(9,9-dimethylfluoren-2-yl)aniline (PubChem CID 58389668) has the molecular formula C56H55N and a molecular weight of 742.06 g/mol. Its IUPAC name is N,N-bis(4-tert-butylphenyl)-3,5-bis(9,9-dimethylfluoren-2-yl)aniline.
| Compound Name | N,N-bis(4-tert-butylphenyl)-3,5-bis(9,9-dimethylfluoren-2-yl)aniline |
|---|---|
| PubChem CID | 58389668 |
| Molecular Formula | C56H55N |
| Molecular Weight | 742.06 g/mol |
| Exact Mass | 741.43 |
| IUPAC Name | N,N-bis(4-tert-butylphenyl)-3,5-bis(9,9-dimethylfluoren-2-yl)aniline |
| SMILES | CC(C)(C)c1ccc(N(c2ccc(C(C)(C)C)cc2)c2cc(-c3ccc4c(c3)C(C)(C)c3ccccc3-4)cc(-c3ccc4c(c3)C(C)(C)c3ccccc3-4)c2)cc1 |
| InChI | InChI=1S/C56H55N/c1-53(2,3)40-21-25-42(26-22-40)57(43-27-23-41(24-28-43)54(4,5)6)44-32-38(36-19-29-47-45-15-11-13-17-49(45)55(7,8)51(47)34-36)31-39(33-44)37-20-30-48-46-16-12-14-18-50(46)56(9,10)52(48)35-37/h11-35H,1-10H3 |
| InChIKey | FHYSIAHBEKLVPM-UHFFFAOYSA-N |
| XLogP | 15.70 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.06 |
| LogP ≤ 5 | 15.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |