C49H41N — CID 58389731
3,5-bis(9,9-dimethylfluoren-2-yl)-N-(4-methylphenyl)-N-phenylaniline (PubChem CID 58389731) has the molecular formula C49H41N and a molecular weight of 643.87 g/mol. Its IUPAC name is 3,5-bis(9,9-dimethylfluoren-2-yl)-N-(4-methylphenyl)-N-phenylaniline.
| Compound Name | 3,5-bis(9,9-dimethylfluoren-2-yl)-N-(4-methylphenyl)-N-phenylaniline |
|---|---|
| PubChem CID | 58389731 |
| Molecular Formula | C49H41N |
| Molecular Weight | 643.87 g/mol |
| Exact Mass | 643.32 |
| IUPAC Name | 3,5-bis(9,9-dimethylfluoren-2-yl)-N-(4-methylphenyl)-N-phenylaniline |
| SMILES | Cc1ccc(N(c2ccccc2)c2cc(-c3ccc4c(c3)C(C)(C)c3ccccc3-4)cc(-c3ccc4c(c3)C(C)(C)c3ccccc3-4)c2)cc1 |
| InChI | InChI=1S/C49H41N/c1-32-19-23-38(24-20-32)50(37-13-7-6-8-14-37)39-28-35(33-21-25-42-40-15-9-11-17-44(40)48(2,3)46(42)30-33)27-36(29-39)34-22-26-43-41-16-10-12-18-45(41)49(4,5)47(43)31-34/h6-31H,1-5H3 |
| InChIKey | AULNINVXOYUVTL-UHFFFAOYSA-N |
| XLogP | 13.41 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.87 |
| LogP ≤ 5 | 13.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |