C60H63N — CID 58389679
4-tert-butyl-N,N-bis(4-tert-butylphenyl)-3,5-bis(9,9-dimethylfluoren-2-yl)aniline (PubChem CID 58389679) has the molecular formula C60H63N and a molecular weight of 798.17 g/mol. Its IUPAC name is 4-tert-butyl-N,N-bis(4-tert-butylphenyl)-3,5-bis(9,9-dimethylfluoren-2-yl)aniline.
| Compound Name | 4-tert-butyl-N,N-bis(4-tert-butylphenyl)-3,5-bis(9,9-dimethylfluoren-2-yl)aniline |
|---|---|
| PubChem CID | 58389679 |
| Molecular Formula | C60H63N |
| Molecular Weight | 798.17 g/mol |
| Exact Mass | 797.50 |
| IUPAC Name | 4-tert-butyl-N,N-bis(4-tert-butylphenyl)-3,5-bis(9,9-dimethylfluoren-2-yl)aniline |
| SMILES | CC(C)(C)c1ccc(N(c2ccc(C(C)(C)C)cc2)c2cc(-c3ccc4c(c3)C(C)(C)c3ccccc3-4)c(C(C)(C)C)c(-c3ccc4c(c3)C(C)(C)c3ccccc3-4)c2)cc1 |
| InChI | InChI=1S/C60H63N/c1-56(2,3)40-24-28-42(29-25-40)61(43-30-26-41(27-31-43)57(4,5)6)44-36-49(38-22-32-47-45-18-14-16-20-51(45)59(10,11)53(47)34-38)55(58(7,8)9)50(37-44)39-23-33-48-46-19-15-17-21-52(46)60(12,13)54(48)35-39/h14-37H,1-13H3 |
| InChIKey | ASPSOGNVXJVBNE-UHFFFAOYSA-N |
| XLogP | 17.00 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 798.17 |
| LogP ≤ 5 | 17.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |