C31H31N — CID 167340405
N-(4-tert-butylphenyl)-9,9-dimethyl-N-phenylfluoren-3-amine (PubChem CID 167340405) has the molecular formula C31H31N and a molecular weight of 417.60 g/mol. Its IUPAC name is N-(4-tert-butylphenyl)-9,9-dimethyl-N-phenylfluoren-3-amine.
| Compound Name | N-(4-tert-butylphenyl)-9,9-dimethyl-N-phenylfluoren-3-amine |
|---|---|
| PubChem CID | 167340405 |
| Molecular Formula | C31H31N |
| Molecular Weight | 417.60 g/mol |
| Exact Mass | 417.25 |
| IUPAC Name | N-(4-tert-butylphenyl)-9,9-dimethyl-N-phenylfluoren-3-amine |
| SMILES | CC(C)(C)c1ccc(N(c2ccccc2)c2ccc3c(c2)-c2ccccc2C3(C)C)cc1 |
| InChI | InChI=1S/C31H31N/c1-30(2,3)22-15-17-24(18-16-22)32(23-11-7-6-8-12-23)25-19-20-29-27(21-25)26-13-9-10-14-28(26)31(29,4)5/h6-21H,1-5H3 |
| InChIKey | FNUOJHFHWUBYKL-UHFFFAOYSA-N |
| XLogP | 8.76 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.60 |
| LogP ≤ 5 | 8.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |