C68H63N — CID 58389701
3,5-bis(7-tert-butyl-9,9-dimethylfluoren-2-yl)-N,N-bis(4-phenylphenyl)aniline (PubChem CID 58389701) has the molecular formula C68H63N and a molecular weight of 894.26 g/mol. Its IUPAC name is 3,5-bis(7-tert-butyl-9,9-dimethylfluoren-2-yl)-N,N-bis(4-phenylphenyl)aniline.
| Compound Name | 3,5-bis(7-tert-butyl-9,9-dimethylfluoren-2-yl)-N,N-bis(4-phenylphenyl)aniline |
|---|---|
| PubChem CID | 58389701 |
| Molecular Formula | C68H63N |
| Molecular Weight | 894.26 g/mol |
| Exact Mass | 893.50 |
| IUPAC Name | 3,5-bis(7-tert-butyl-9,9-dimethylfluoren-2-yl)-N,N-bis(4-phenylphenyl)aniline |
| SMILES | CC(C)(C)c1ccc2c(c1)C(C)(C)c1cc(-c3cc(-c4ccc5c(c4)C(C)(C)c4cc(C(C)(C)C)ccc4-5)cc(N(c4ccc(-c5ccccc5)cc4)c4ccc(-c5ccccc5)cc4)c3)ccc1-2 |
| InChI | InChI=1S/C68H63N/c1-65(2,3)52-27-35-59-57-33-25-48(40-61(57)67(7,8)63(59)42-52)50-37-51(49-26-34-58-60-36-28-53(66(4,5)6)43-64(60)68(9,10)62(58)41-49)39-56(38-50)69(54-29-21-46(22-30-54)44-17-13-11-14-18-44)55-31-23-47(24-32-55)45-19-15-12-16-20-45/h11-43H,1-10H3 |
| InChIKey | PKNXOUCDMXWODU-UHFFFAOYSA-N |
| XLogP | 19.03 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 894.26 |
| LogP ≤ 5 | 19.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |