C57H57N — CID 58389703
N,N-bis(4-tert-butylphenyl)-3,5-bis(9,9-dimethylfluoren-2-yl)-4-methylaniline (PubChem CID 58389703) has the molecular formula C57H57N and a molecular weight of 756.09 g/mol. Its IUPAC name is N,N-bis(4-tert-butylphenyl)-3,5-bis(9,9-dimethylfluoren-2-yl)-4-methylaniline.
| Compound Name | N,N-bis(4-tert-butylphenyl)-3,5-bis(9,9-dimethylfluoren-2-yl)-4-methylaniline |
|---|---|
| PubChem CID | 58389703 |
| Molecular Formula | C57H57N |
| Molecular Weight | 756.09 g/mol |
| Exact Mass | 755.45 |
| IUPAC Name | N,N-bis(4-tert-butylphenyl)-3,5-bis(9,9-dimethylfluoren-2-yl)-4-methylaniline |
| SMILES | Cc1c(-c2ccc3c(c2)C(C)(C)c2ccccc2-3)cc(N(c2ccc(C(C)(C)C)cc2)c2ccc(C(C)(C)C)cc2)cc1-c1ccc2c(c1)C(C)(C)c1ccccc1-2 |
| InChI | InChI=1S/C57H57N/c1-36-48(37-20-30-46-44-16-12-14-18-50(44)56(8,9)52(46)32-37)34-43(35-49(36)38-21-31-47-45-17-13-15-19-51(45)57(10,11)53(47)33-38)58(41-26-22-39(23-27-41)54(2,3)4)42-28-24-40(25-29-42)55(5,6)7/h12-35H,1-11H3 |
| InChIKey | IJCCYJUPHZWCPJ-UHFFFAOYSA-N |
| XLogP | 16.01 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.09 |
| LogP ≤ 5 | 16.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |