C65H73N — CID 58389712
3,5-bis(7-tert-butyl-9,9-dimethylfluoren-2-yl)-N,N-bis(4-tert-butylphenyl)-4-methylaniline (PubChem CID 58389712) has the molecular formula C65H73N and a molecular weight of 868.31 g/mol. Its IUPAC name is 3,5-bis(7-tert-butyl-9,9-dimethylfluoren-2-yl)-N,N-bis(4-tert-butylphenyl)-4-methylaniline.
| Compound Name | 3,5-bis(7-tert-butyl-9,9-dimethylfluoren-2-yl)-N,N-bis(4-tert-butylphenyl)-4-methylaniline |
|---|---|
| PubChem CID | 58389712 |
| Molecular Formula | C65H73N |
| Molecular Weight | 868.31 g/mol |
| Exact Mass | 867.57 |
| IUPAC Name | 3,5-bis(7-tert-butyl-9,9-dimethylfluoren-2-yl)-N,N-bis(4-tert-butylphenyl)-4-methylaniline |
| SMILES | Cc1c(-c2ccc3c(c2)C(C)(C)c2cc(C(C)(C)C)ccc2-3)cc(N(c2ccc(C(C)(C)C)cc2)c2ccc(C(C)(C)C)cc2)cc1-c1ccc2c(c1)C(C)(C)c1cc(C(C)(C)C)ccc1-2 |
| InChI | InChI=1S/C65H73N/c1-40-54(41-18-30-50-52-32-24-45(62(8,9)10)36-58(52)64(14,15)56(50)34-41)38-49(66(47-26-20-43(21-27-47)60(2,3)4)48-28-22-44(23-29-48)61(5,6)7)39-55(40)42-19-31-51-53-33-25-46(63(11,12)13)37-59(53)65(16,17)57(51)35-42/h18-39H,1-17H3 |
| InChIKey | ZICLZQOYGFLEGD-UHFFFAOYSA-N |
| XLogP | 18.60 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 868.31 |
| LogP ≤ 5 | 18.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |