C63H58N2 — CID 122416670
2-N,8-N-bis(4-tert-butylphenyl)-11,11-dimethyl-2-N,8-N-bis(4-phenylphenyl)benzo[b]fluorene-2,8-diamine (PubChem CID 122416670) has the molecular formula C63H58N2 and a molecular weight of 843.17 g/mol. Its IUPAC name is 2-N,8-N-bis(4-tert-butylphenyl)-11,11-dimethyl-2-N,8-N-bis(4-phenylphenyl)benzo[b]fluorene-2,8-diamine.
| Compound Name | 2-N,8-N-bis(4-tert-butylphenyl)-11,11-dimethyl-2-N,8-N-bis(4-phenylphenyl)benzo[b]fluorene-2,8-diamine |
|---|---|
| PubChem CID | 122416670 |
| Molecular Formula | C63H58N2 |
| Molecular Weight | 843.17 g/mol |
| Exact Mass | 842.46 |
| IUPAC Name | 2-N,8-N-bis(4-tert-butylphenyl)-11,11-dimethyl-2-N,8-N-bis(4-phenylphenyl)benzo[b]fluorene-2,8-diamine |
| SMILES | CC(C)(C)c1ccc(N(c2ccc(-c3ccccc3)cc2)c2ccc3c(c2)C(C)(C)c2cc4cc(N(c5ccc(-c6ccccc6)cc5)c5ccc(C(C)(C)C)cc5)ccc4cc2-3)cc1 |
| InChI | InChI=1S/C63H58N2/c1-61(2,3)49-24-33-53(34-25-49)64(51-28-19-45(20-29-51)43-15-11-9-12-16-43)55-32-23-47-40-58-57-38-37-56(42-60(57)63(7,8)59(58)41-48(47)39-55)65(54-35-26-50(27-36-54)62(4,5)6)52-30-21-46(22-31-52)44-17-13-10-14-18-44/h9-42H,1-8H3 |
| InChIKey | ZAWKAASZCNTLLB-UHFFFAOYSA-N |
| XLogP | 18.01 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 843.17 |
| LogP ≤ 5 | 18.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |