C48H44 — CID 59782429
3,9,9-trimethyl-2,7-bis(3,9,9-trimethylfluoren-2-yl)fluorene (PubChem CID 59782429) has the molecular formula C48H44 and a molecular weight of 620.88 g/mol. Its IUPAC name is 3,9,9-trimethyl-2,7-bis(3,9,9-trimethylfluoren-2-yl)fluorene.
| Compound Name | 3,9,9-trimethyl-2,7-bis(3,9,9-trimethylfluoren-2-yl)fluorene |
|---|---|
| PubChem CID | 59782429 |
| Molecular Formula | C48H44 |
| Molecular Weight | 620.88 g/mol |
| Exact Mass | 620.34 |
| IUPAC Name | 3,9,9-trimethyl-2,7-bis(3,9,9-trimethylfluoren-2-yl)fluorene |
| SMILES | Cc1cc2c(cc1-c1ccc3c(c1)C(C)(C)c1cc(-c4cc5c(cc4C)-c4ccccc4C5(C)C)c(C)cc1-3)C(C)(C)c1ccccc1-2 |
| InChI | InChI=1S/C48H44/c1-27-20-37-31-14-10-12-16-40(31)46(4,5)43(37)24-34(27)30-18-19-33-39-22-29(3)36(26-45(39)48(8,9)42(33)23-30)35-25-44-38(21-28(35)2)32-15-11-13-17-41(32)47(44,6)7/h10-26H,1-9H3 |
| InChIKey | UGUSLLGNAGLIAT-UHFFFAOYSA-N |
| XLogP | 12.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.88 |
| LogP ≤ 5 | 12.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |