C46H42 — CID 59782340
3,6,9,9-tetramethyl-2-phenyl-7-(3,6,9,9-tetramethyl-7-phenylfluoren-2-yl)fluorene (PubChem CID 59782340) has the molecular formula C46H42 and a molecular weight of 594.84 g/mol. Its IUPAC name is 3,6,9,9-tetramethyl-2-phenyl-7-(3,6,9,9-tetramethyl-7-phenylfluoren-2-yl)fluorene.
| Compound Name | 3,6,9,9-tetramethyl-2-phenyl-7-(3,6,9,9-tetramethyl-7-phenylfluoren-2-yl)fluorene |
|---|---|
| PubChem CID | 59782340 |
| Molecular Formula | C46H42 |
| Molecular Weight | 594.84 g/mol |
| Exact Mass | 594.33 |
| IUPAC Name | 3,6,9,9-tetramethyl-2-phenyl-7-(3,6,9,9-tetramethyl-7-phenylfluoren-2-yl)fluorene |
| SMILES | Cc1cc2c(cc1-c1ccccc1)C(C)(C)c1cc(-c3cc4c(cc3C)-c3cc(C)c(-c5ccccc5)cc3C4(C)C)c(C)cc1-2 |
| InChI | InChI=1S/C46H42/c1-27-19-37-39-21-29(3)35(25-43(39)45(5,6)41(37)23-33(27)31-15-11-9-12-16-31)36-26-44-40(22-30(36)4)38-20-28(2)34(24-42(38)46(44,7)8)32-17-13-10-14-18-32/h9-26H,1-8H3 |
| InChIKey | CBLMXAGHCFCQCJ-UHFFFAOYSA-N |
| XLogP | 12.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.84 |
| LogP ≤ 5 | 12.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |