C19H22 — CID 59701923
2,3,6,7,9,9-hexamethylfluorene (PubChem CID 59701923) has the molecular formula C19H22 and a molecular weight of 250.38 g/mol. Its IUPAC name is 2,3,6,7,9,9-hexamethylfluorene.
| Compound Name | 2,3,6,7,9,9-hexamethylfluorene |
|---|---|
| PubChem CID | 59701923 |
| Molecular Formula | C19H22 |
| Molecular Weight | 250.38 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | 2,3,6,7,9,9-hexamethylfluorene |
| SMILES | Cc1cc2c(cc1C)C(C)(C)c1cc(C)c(C)cc1-2 |
| InChI | InChI=1S/C19H22/c1-11-7-15-16-8-12(2)14(4)10-18(16)19(5,6)17(15)9-13(11)3/h7-10H,1-6H3 |
| InChIKey | YZEGXULWOGVZPI-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.38 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |