C15H16N2 — CID 156512652
9,9-dimethylfluorene-2,6-diamine (PubChem CID 156512652) has the molecular formula C15H16N2 and a molecular weight of 224.31 g/mol. Its IUPAC name is 9,9-dimethylfluorene-2,6-diamine.
| Compound Name | 9,9-dimethylfluorene-2,6-diamine |
|---|---|
| PubChem CID | 156512652 |
| Molecular Formula | C15H16N2 |
| Molecular Weight | 224.31 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | 9,9-dimethylfluorene-2,6-diamine |
| SMILES | CC1(C)c2ccc(N)cc2-c2ccc(N)cc21 |
| InChI | InChI=1S/C15H16N2/c1-15(2)13-6-4-9(16)7-12(13)11-5-3-10(17)8-14(11)15/h3-8H,16-17H2,1-2H3 |
| InChIKey | ZZWVTTVSCIRFHR-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.31 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|