C32H28N2 — CID 141433409
5-(9,9-dimethylfluoren-2-yl)-10,10-dimethylindeno[1,2-b]indol-3-amine (PubChem CID 141433409) has the molecular formula C32H28N2 and a molecular weight of 440.59 g/mol. Its IUPAC name is 5-(9,9-dimethylfluoren-2-yl)-10,10-dimethylindeno[1,2-b]indol-3-amine.
| Compound Name | 5-(9,9-dimethylfluoren-2-yl)-10,10-dimethylindeno[1,2-b]indol-3-amine |
|---|---|
| PubChem CID | 141433409 |
| Molecular Formula | C32H28N2 |
| Molecular Weight | 440.59 g/mol |
| Exact Mass | 440.23 |
| IUPAC Name | 5-(9,9-dimethylfluoren-2-yl)-10,10-dimethylindeno[1,2-b]indol-3-amine |
| SMILES | CC1(C)c2ccccc2-c2ccc(-n3c4c(c5ccccc53)C(C)(C)c3ccc(N)cc3-4)cc21 |
| InChI | InChI=1S/C32H28N2/c1-31(2)25-11-7-5-9-21(25)22-15-14-20(18-27(22)31)34-28-12-8-6-10-23(28)29-30(34)24-17-19(33)13-16-26(24)32(29,3)4/h5-18H,33H2,1-4H3 |
| InChIKey | SSXJGYNMZADJIR-UHFFFAOYSA-N |
| XLogP | 7.83 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.59 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|