C30H26BN — CID 89272647
CID 89272647 (PubChem CID 89272647) has the molecular formula C30H26BN and a molecular weight of 411.36 g/mol.
| Compound Name | CID 89272647 |
|---|---|
| PubChem CID | 89272647 |
| Molecular Formula | C30H26BN |
| Molecular Weight | 411.36 g/mol |
| Exact Mass | 411.22 |
| IUPAC Name | — |
| SMILES | [B]c1ccc2c(c1)C(C)(C)c1cc(-c3ccc4c(c3)C(C)(C)c3cc(N)ccc3-4)ccc1-2 |
| InChI | InChI=1S/C30H26BN/c1-29(2)25-13-17(5-9-21(25)23-11-7-19(31)15-27(23)29)18-6-10-22-24-12-8-20(32)16-28(24)30(3,4)26(22)14-18/h5-16H,32H2,1-4H3 |
| InChIKey | MVBZQGWOMCXMQQ-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.36 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|