C27H22O2 — CID 18714128
4-[7-(4-hydroxyphenyl)-9,9-dimethylfluoren-2-yl]phenol (PubChem CID 18714128) has the molecular formula C27H22O2 and a molecular weight of 378.47 g/mol. Its IUPAC name is 4-[7-(4-hydroxyphenyl)-9,9-dimethylfluoren-2-yl]phenol.
| Compound Name | 4-[7-(4-hydroxyphenyl)-9,9-dimethylfluoren-2-yl]phenol |
|---|---|
| PubChem CID | 18714128 |
| Molecular Formula | C27H22O2 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | 4-[7-(4-hydroxyphenyl)-9,9-dimethylfluoren-2-yl]phenol |
| SMILES | CC1(C)c2cc(-c3ccc(O)cc3)ccc2-c2ccc(-c3ccc(O)cc3)cc21 |
| InChI | InChI=1S/C27H22O2/c1-27(2)25-15-19(17-3-9-21(28)10-4-17)7-13-23(25)24-14-8-20(16-26(24)27)18-5-11-22(29)12-6-18/h3-16,28-29H,1-2H3 |
| InChIKey | YVZYZHWUJOGQFF-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |