C46H44O2 — CID 123523124
4-[4-[7-[4-(4-hydroxyphenyl)phenyl]-9-methyl-9-octylfluoren-2-yl]phenyl]phenol (PubChem CID 123523124) has the molecular formula C46H44O2 and a molecular weight of 628.86 g/mol. Its IUPAC name is 4-[4-[7-[4-(4-hydroxyphenyl)phenyl]-9-methyl-9-octylfluoren-2-yl]phenyl]phenol.
| Compound Name | 4-[4-[7-[4-(4-hydroxyphenyl)phenyl]-9-methyl-9-octylfluoren-2-yl]phenyl]phenol |
|---|---|
| PubChem CID | 123523124 |
| Molecular Formula | C46H44O2 |
| Molecular Weight | 628.86 g/mol |
| Exact Mass | 628.33 |
| IUPAC Name | 4-[4-[7-[4-(4-hydroxyphenyl)phenyl]-9-methyl-9-octylfluoren-2-yl]phenyl]phenol |
| SMILES | CCCCCCCCC1(C)c2cc(-c3ccc(-c4ccc(O)cc4)cc3)ccc2-c2ccc(-c3ccc(-c4ccc(O)cc4)cc3)cc21 |
| InChI | InChI=1S/C46H44O2/c1-3-4-5-6-7-8-29-46(2)44-30-38(36-13-9-32(10-14-36)34-17-23-40(47)24-18-34)21-27-42(44)43-28-22-39(31-45(43)46)37-15-11-33(12-16-37)35-19-25-41(48)26-20-35/h9-28,30-31,47-48H,3-8,29H2,1-2H3 |
| InChIKey | JGVKCYDGVMFTFV-UHFFFAOYSA-N |
| XLogP | 12.80 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.86 |
| LogP ≤ 5 | 12.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|