C56H52N4 — CID 123990852
4-[9-methyl-7-[2-(4-methylphenyl)-6-phenylpyrimidin-4-yl]-9-octylfluoren-2-yl]-2-(4-methylphenyl)-6-phenylpyrimidine (PubChem CID 123990852) has the molecular formula C56H52N4 and a molecular weight of 781.06 g/mol. Its IUPAC name is 4-[9-methyl-7-[2-(4-methylphenyl)-6-phenylpyrimidin-4-yl]-9-octylfluoren-2-yl]-2-(4-methylphenyl)-6-phenylpyrimidine.
| Compound Name | 4-[9-methyl-7-[2-(4-methylphenyl)-6-phenylpyrimidin-4-yl]-9-octylfluoren-2-yl]-2-(4-methylphenyl)-6-phenylpyrimidine |
|---|---|
| PubChem CID | 123990852 |
| Molecular Formula | C56H52N4 |
| Molecular Weight | 781.06 g/mol |
| Exact Mass | 780.42 |
| IUPAC Name | 4-[9-methyl-7-[2-(4-methylphenyl)-6-phenylpyrimidin-4-yl]-9-octylfluoren-2-yl]-2-(4-methylphenyl)-6-phenylpyrimidine |
| SMILES | CCCCCCCCC1(C)c2cc(-c3cc(-c4ccccc4)nc(-c4ccc(C)cc4)n3)ccc2-c2ccc(-c3cc(-c4ccccc4)nc(-c4ccc(C)cc4)n3)cc21 |
| InChI | InChI=1S/C56H52N4/c1-5-6-7-8-9-16-33-56(4)48-34-44(52-36-50(40-17-12-10-13-18-40)57-54(59-52)42-25-21-38(2)22-26-42)29-31-46(48)47-32-30-45(35-49(47)56)53-37-51(41-19-14-11-15-20-41)58-55(60-53)43-27-23-39(3)24-28-43/h10-15,17-32,34-37H,5-9,16,33H2,1-4H3 |
| InChIKey | COKGQAZFFQRNLD-UHFFFAOYSA-N |
| XLogP | 14.92 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 781.06 |
| LogP ≤ 5 | 14.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|