C63H66N4 — CID 118345693
2-(4,6-diphenylpyrimidin-2-yl)-4-(7-methyl-9,9-dioctylfluoren-2-yl)-6-[4-(4-methylphenyl)phenyl]pyrimidine (PubChem CID 118345693) has the molecular formula C63H66N4 and a molecular weight of 879.25 g/mol. Its IUPAC name is 2-(4,6-diphenylpyrimidin-2-yl)-4-(7-methyl-9,9-dioctylfluoren-2-yl)-6-[4-(4-methylphenyl)phenyl]pyrimidine.
| Compound Name | 2-(4,6-diphenylpyrimidin-2-yl)-4-(7-methyl-9,9-dioctylfluoren-2-yl)-6-[4-(4-methylphenyl)phenyl]pyrimidine |
|---|---|
| PubChem CID | 118345693 |
| Molecular Formula | C63H66N4 |
| Molecular Weight | 879.25 g/mol |
| Exact Mass | 878.53 |
| IUPAC Name | 2-(4,6-diphenylpyrimidin-2-yl)-4-(7-methyl-9,9-dioctylfluoren-2-yl)-6-[4-(4-methylphenyl)phenyl]pyrimidine |
| SMILES | CCCCCCCCC1(CCCCCCCC)c2cc(C)ccc2-c2ccc(-c3cc(-c4ccc(-c5ccc(C)cc5)cc4)nc(-c4nc(-c5ccccc5)cc(-c5ccccc5)n4)n3)cc21 |
| InChI | InChI=1S/C63H66N4/c1-5-7-9-11-13-21-39-63(40-22-14-12-10-8-6-2)55-41-46(4)29-37-53(55)54-38-36-52(42-56(54)63)60-44-59(51-34-32-48(33-35-51)47-30-27-45(3)28-31-47)66-62(67-60)61-64-57(49-23-17-15-18-24-49)43-58(65-61)50-25-19-16-20-26-50/h15-20,23-38,41-44H,5-14,21-22,39-40H2,1-4H3 |
| InChIKey | CTXKAKQCSXDAIY-UHFFFAOYSA-N |
| XLogP | 17.65 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 879.25 |
| LogP ≤ 5 | 17.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|