C53H54F4O2 — CID 126501924
4-[4-[9-(1,1-difluorooctyl)-9-(2,2-difluorooctyl)-7-[4-(4-hydroxyphenyl)phenyl]fluoren-2-yl]phenyl]phenol (PubChem CID 126501924) has the molecular formula C53H54F4O2 and a molecular weight of 799.01 g/mol. Its IUPAC name is 4-[4-[9-(1,1-difluorooctyl)-9-(2,2-difluorooctyl)-7-[4-(4-hydroxyphenyl)phenyl]fluoren-2-yl]phenyl]phenol.
| Compound Name | 4-[4-[9-(1,1-difluorooctyl)-9-(2,2-difluorooctyl)-7-[4-(4-hydroxyphenyl)phenyl]fluoren-2-yl]phenyl]phenol |
|---|---|
| PubChem CID | 126501924 |
| Molecular Formula | C53H54F4O2 |
| Molecular Weight | 799.01 g/mol |
| Exact Mass | 798.41 |
| IUPAC Name | 4-[4-[9-(1,1-difluorooctyl)-9-(2,2-difluorooctyl)-7-[4-(4-hydroxyphenyl)phenyl]fluoren-2-yl]phenyl]phenol |
| SMILES | CCCCCCCC(F)(F)C1(CC(F)(F)CCCCCC)c2cc(-c3ccc(-c4ccc(O)cc4)cc3)ccc2-c2ccc(-c3ccc(-c4ccc(O)cc4)cc3)cc21 |
| InChI | InChI=1S/C53H54F4O2/c1-3-5-7-9-11-33-53(56,57)52(36-51(54,55)32-10-8-6-4-2)49-34-43(41-16-12-37(13-17-41)39-20-26-45(58)27-21-39)24-30-47(49)48-31-25-44(35-50(48)52)42-18-14-38(15-19-42)40-22-28-46(59)29-23-40/h12-31,34-35,58-59H,3-11,32-33,36H2,1-2H3 |
| InChIKey | MOZYPZPHOWCZBL-UHFFFAOYSA-N |
| XLogP | 16.02 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 799.01 |
| LogP ≤ 5 | 16.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|