C53H49BrF18 — CID 161366573
2,7-bis[3,5-bis(trifluoromethyl)phenyl]-9,9-dioctylfluorene;1-bromo-3,5-bis(trifluoromethyl)benzene (PubChem CID 161366573) has the molecular formula C53H49BrF18 and a molecular weight of 1107.84 g/mol. Its IUPAC name is 2,7-bis[3,5-bis(trifluoromethyl)phenyl]-9,9-dioctylfluorene;1-bromo-3,5-bis(trifluoromethyl)benzene.
| Compound Name | 2,7-bis[3,5-bis(trifluoromethyl)phenyl]-9,9-dioctylfluorene;1-bromo-3,5-bis(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 161366573 |
| Molecular Formula | C53H49BrF18 |
| Molecular Weight | 1107.84 g/mol |
| Exact Mass | 1106.27 |
| IUPAC Name | 2,7-bis[3,5-bis(trifluoromethyl)phenyl]-9,9-dioctylfluorene;1-bromo-3,5-bis(trifluoromethyl)benzene |
| SMILES | CCCCCCCCC1(CCCCCCCC)c2cc(-c3cc(C(F)(F)F)cc(C(F)(F)F)c3)ccc2-c2ccc(-c3cc(C(F)(F)F)cc(C(F)(F)F)c3)cc21.FC(F)(F)c1cc(Br)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C45H46F12.C8H3BrF6/c1-3-5-7-9-11-13-19-41(20-14-12-10-8-6-4-2)39-25-29(31-21-33(42(46,47)48)27-34(22-31)43(49,50)51)15-17-37(39)38-18-16-30(26-40(38)41)32-23-35(44(52,53)54)28-36(24-32)45(55,56)57;9-6-2-4(7(10,11)12)1-5(3-6)8(13,14)15/h15-18,21-28H,3-14,19-20H2,1-2H3;1-3H |
| InChIKey | VPWVCDPKQOOABK-UHFFFAOYSA-N |
| XLogP | 21.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 16 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1107.84 |
| LogP ≤ 5 | 21.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|