C55H57Br — CID 59512866
2-bromo-7-[7-(9,9-dihexylfluoren-2-yl)-9,9-dimethylfluoren-2-yl]-9,9-dimethylfluorene (PubChem CID 59512866) has the molecular formula C55H57Br and a molecular weight of 797.96 g/mol. Its IUPAC name is 2-bromo-7-[7-(9,9-dihexylfluoren-2-yl)-9,9-dimethylfluoren-2-yl]-9,9-dimethylfluorene.
| Compound Name | 2-bromo-7-[7-(9,9-dihexylfluoren-2-yl)-9,9-dimethylfluoren-2-yl]-9,9-dimethylfluorene |
|---|---|
| PubChem CID | 59512866 |
| Molecular Formula | C55H57Br |
| Molecular Weight | 797.96 g/mol |
| Exact Mass | 796.36 |
| IUPAC Name | 2-bromo-7-[7-(9,9-dihexylfluoren-2-yl)-9,9-dimethylfluoren-2-yl]-9,9-dimethylfluorene |
| SMILES | CCCCCCC1(CCCCCC)c2ccccc2-c2ccc(-c3ccc4c(c3)C(C)(C)c3cc(-c5ccc6c(c5)C(C)(C)c5cc(Br)ccc5-6)ccc3-4)cc21 |
| InChI | InChI=1S/C55H57Br/c1-7-9-11-15-29-55(30-16-12-10-8-2)47-18-14-13-17-41(47)46-27-22-39(34-52(46)55)38-21-25-43-42-24-19-36(31-48(42)53(3,4)49(43)33-38)37-20-26-44-45-28-23-40(56)35-51(45)54(5,6)50(44)32-37/h13-14,17-28,31-35H,7-12,15-16,29-30H2,1-6H3 |
| InChIKey | TVKMRNYDJBPUOI-UHFFFAOYSA-N |
| XLogP | 16.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 797.96 |
| LogP ≤ 5 | 16.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|