C67H73Br — CID 145436592
2-(4-bromo-3,5-dimethylphenyl)-7-[7-(9,9-dioctylfluoren-2-yl)-9,9-dimethylfluoren-2-yl]-9,9-dimethylfluorene (PubChem CID 145436592) has the molecular formula C67H73Br and a molecular weight of 958.22 g/mol. Its IUPAC name is 2-(4-bromo-3,5-dimethylphenyl)-7-[7-(9,9-dioctylfluoren-2-yl)-9,9-dimethylfluoren-2-yl]-9,9-dimethylfluorene.
| Compound Name | 2-(4-bromo-3,5-dimethylphenyl)-7-[7-(9,9-dioctylfluoren-2-yl)-9,9-dimethylfluoren-2-yl]-9,9-dimethylfluorene |
|---|---|
| PubChem CID | 145436592 |
| Molecular Formula | C67H73Br |
| Molecular Weight | 958.22 g/mol |
| Exact Mass | 956.49 |
| IUPAC Name | 2-(4-bromo-3,5-dimethylphenyl)-7-[7-(9,9-dioctylfluoren-2-yl)-9,9-dimethylfluoren-2-yl]-9,9-dimethylfluorene |
| SMILES | CCCCCCCCC1(CCCCCCCC)c2ccccc2-c2ccc(-c3ccc4c(c3)C(C)(C)c3cc(-c5ccc6c(c5)C(C)(C)c5cc(-c7cc(C)c(Br)c(C)c7)ccc5-6)ccc3-4)cc21 |
| InChI | InChI=1S/C67H73Br/c1-9-11-13-15-17-21-35-67(36-22-18-16-14-12-10-2)58-24-20-19-23-52(58)57-34-28-49(43-63(57)67)48-27-32-54-53-30-25-46(39-59(53)65(5,6)61(54)41-48)47-26-31-55-56-33-29-50(42-62(56)66(7,8)60(55)40-47)51-37-44(3)64(68)45(4)38-51/h19-20,23-34,37-43H,9-18,21-22,35-36H2,1-8H3 |
| InChIKey | QATGHFFOLKNKHZ-UHFFFAOYSA-N |
| XLogP | 20.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 17 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 958.22 |
| LogP ≤ 5 | 20.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|