C31H34O2 — CID 91334684
ethane;4-[6-(4-hydroxyphenyl)-9,9-dimethylfluoren-3-yl]phenol (PubChem CID 91334684) has the molecular formula C31H34O2 and a molecular weight of 438.61 g/mol. Its IUPAC name is ethane;4-[6-(4-hydroxyphenyl)-9,9-dimethylfluoren-3-yl]phenol.
| Compound Name | ethane;4-[6-(4-hydroxyphenyl)-9,9-dimethylfluoren-3-yl]phenol |
|---|---|
| PubChem CID | 91334684 |
| Molecular Formula | C31H34O2 |
| Molecular Weight | 438.61 g/mol |
| Exact Mass | 438.26 |
| IUPAC Name | ethane;4-[6-(4-hydroxyphenyl)-9,9-dimethylfluoren-3-yl]phenol |
| SMILES | CC.CC.CC1(C)c2ccc(-c3ccc(O)cc3)cc2-c2cc(-c3ccc(O)cc3)ccc21 |
| InChI | InChI=1S/C27H22O2.2C2H6/c1-27(2)25-13-7-19(17-3-9-21(28)10-4-17)15-23(25)24-16-20(8-14-26(24)27)18-5-11-22(29)12-6-18;2*1-2/h3-16,28-29H,1-2H3;2*1-2H3 |
| InChIKey | NOQXDYIYDWVNIG-UHFFFAOYSA-N |
| XLogP | 8.79 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.61 |
| LogP ≤ 5 | 8.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |