C25H26 — CID 167353665
3-(3-tert-butylphenyl)-9,9-dimethylfluorene (PubChem CID 167353665) has the molecular formula C25H26 and a molecular weight of 326.48 g/mol. Its IUPAC name is 3-(3-tert-butylphenyl)-9,9-dimethylfluorene.
| Compound Name | 3-(3-tert-butylphenyl)-9,9-dimethylfluorene |
|---|---|
| PubChem CID | 167353665 |
| Molecular Formula | C25H26 |
| Molecular Weight | 326.48 g/mol |
| Exact Mass | 326.20 |
| IUPAC Name | 3-(3-tert-butylphenyl)-9,9-dimethylfluorene |
| SMILES | CC(C)(C)c1cccc(-c2ccc3c(c2)-c2ccccc2C3(C)C)c1 |
| InChI | InChI=1S/C25H26/c1-24(2,3)19-10-8-9-17(15-19)18-13-14-23-21(16-18)20-11-6-7-12-22(20)25(23,4)5/h6-16H,1-5H3 |
| InChIKey | UFTOEOZPBDLHJD-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.48 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |