C37H35N — CID 177100109
N-tert-butyl-N-[4-(9,9-dimethylfluoren-3-yl)phenyl]-4-phenylaniline (PubChem CID 177100109) has the molecular formula C37H35N and a molecular weight of 493.69 g/mol. Its IUPAC name is N-tert-butyl-N-[4-(9,9-dimethylfluoren-3-yl)phenyl]-4-phenylaniline.
| Compound Name | N-tert-butyl-N-[4-(9,9-dimethylfluoren-3-yl)phenyl]-4-phenylaniline |
|---|---|
| PubChem CID | 177100109 |
| Molecular Formula | C37H35N |
| Molecular Weight | 493.69 g/mol |
| Exact Mass | 493.28 |
| IUPAC Name | N-tert-butyl-N-[4-(9,9-dimethylfluoren-3-yl)phenyl]-4-phenylaniline |
| SMILES | CC1(C)c2ccccc2-c2cc(-c3ccc(N(c4ccc(-c5ccccc5)cc4)C(C)(C)C)cc3)ccc21 |
| InChI | InChI=1S/C37H35N/c1-36(2,3)38(30-20-15-27(16-21-30)26-11-7-6-8-12-26)31-22-17-28(18-23-31)29-19-24-35-33(25-29)32-13-9-10-14-34(32)37(35,4)5/h6-25H,1-5H3 |
| InChIKey | GMRNCMMHLPHNFT-UHFFFAOYSA-N |
| XLogP | 10.26 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.69 |
| LogP ≤ 5 | 10.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |