C25H25F — CID 90264154
3-(4-tert-butyl-3-fluorophenyl)-9,9-dimethylfluorene (PubChem CID 90264154) has the molecular formula C25H25F and a molecular weight of 344.47 g/mol. Its IUPAC name is 3-(4-tert-butyl-3-fluorophenyl)-9,9-dimethylfluorene.
| Compound Name | 3-(4-tert-butyl-3-fluorophenyl)-9,9-dimethylfluorene |
|---|---|
| PubChem CID | 90264154 |
| Molecular Formula | C25H25F |
| Molecular Weight | 344.47 g/mol |
| Exact Mass | 344.19 |
| IUPAC Name | 3-(4-tert-butyl-3-fluorophenyl)-9,9-dimethylfluorene |
| SMILES | CC(C)(C)c1ccc(-c2ccc3c(c2)-c2ccccc2C3(C)C)cc1F |
| InChI | InChI=1S/C25H25F/c1-24(2,3)22-13-11-17(15-23(22)26)16-10-12-21-19(14-16)18-8-6-7-9-20(18)25(21,4)5/h6-15H,1-5H3 |
| InChIKey | VURRSDOPPMGNMQ-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.47 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |