C15H13F — CID 130217991
3-fluoro-9,9-dimethylfluorene (PubChem CID 130217991) has the molecular formula C15H13F and a molecular weight of 212.27 g/mol. Its IUPAC name is 3-fluoro-9,9-dimethylfluorene.
| Compound Name | 3-fluoro-9,9-dimethylfluorene |
|---|---|
| PubChem CID | 130217991 |
| Molecular Formula | C15H13F |
| Molecular Weight | 212.27 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | 3-fluoro-9,9-dimethylfluorene |
| SMILES | CC1(C)c2ccccc2-c2cc(F)ccc21 |
| InChI | InChI=1S/C15H13F/c1-15(2)13-6-4-3-5-11(13)12-9-10(16)7-8-14(12)15/h3-9H,1-2H3 |
| InChIKey | MNIKAGYIZDDBQY-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.27 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |