C30H28N2 — CID 166930053
1,1-bis(9,9-dimethylfluoren-3-yl)hydrazine (PubChem CID 166930053) has the molecular formula C30H28N2 and a molecular weight of 416.57 g/mol. Its IUPAC name is 1,1-bis(9,9-dimethylfluoren-3-yl)hydrazine.
| Compound Name | 1,1-bis(9,9-dimethylfluoren-3-yl)hydrazine |
|---|---|
| PubChem CID | 166930053 |
| Molecular Formula | C30H28N2 |
| Molecular Weight | 416.57 g/mol |
| Exact Mass | 416.23 |
| IUPAC Name | 1,1-bis(9,9-dimethylfluoren-3-yl)hydrazine |
| SMILES | CC1(C)c2ccccc2-c2cc(N(N)c3ccc4c(c3)-c3ccccc3C4(C)C)ccc21 |
| InChI | InChI=1S/C30H28N2/c1-29(2)25-11-7-5-9-21(25)23-17-19(13-15-27(23)29)32(31)20-14-16-28-24(18-20)22-10-6-8-12-26(22)30(28,3)4/h5-18H,31H2,1-4H3 |
| InChIKey | JXSZYSJNUCSBEL-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.57 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|