C15H17NS — CID 142283327
9,9-dimethylfluoren-2-amine;sulfane (PubChem CID 142283327) has the molecular formula C15H17NS and a molecular weight of 243.38 g/mol. Its IUPAC name is 9,9-dimethylfluoren-2-amine;sulfane.
| Compound Name | 9,9-dimethylfluoren-2-amine;sulfane |
|---|---|
| PubChem CID | 142283327 |
| Molecular Formula | C15H17NS |
| Molecular Weight | 243.38 g/mol |
| Exact Mass | 243.11 |
| IUPAC Name | 9,9-dimethylfluoren-2-amine;sulfane |
| SMILES | CC1(C)c2ccccc2-c2ccc(N)cc21.S |
| InChI | InChI=1S/C15H15N.H2S/c1-15(2)13-6-4-3-5-11(13)12-8-7-10(16)9-14(12)15;/h3-9H,16H2,1-2H3;1H2 |
| InChIKey | IRDNTHBPDCBQOI-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.38 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|