C41H41N3 — CID 144876651
9,9-dimethylfluoren-2-amine;hydrazine;2-(1-inden-5-ylethyl)-9,9-dimethylfluorene (PubChem CID 144876651) has the molecular formula C41H41N3 and a molecular weight of 575.80 g/mol. Its IUPAC name is 9,9-dimethylfluoren-2-amine;hydrazine;2-(1-inden-5-ylethyl)-9,9-dimethylfluorene.
| Compound Name | 9,9-dimethylfluoren-2-amine;hydrazine;2-(1-inden-5-ylethyl)-9,9-dimethylfluorene |
|---|---|
| PubChem CID | 144876651 |
| Molecular Formula | C41H41N3 |
| Molecular Weight | 575.80 g/mol |
| Exact Mass | 575.33 |
| IUPAC Name | 9,9-dimethylfluoren-2-amine;hydrazine;2-(1-inden-5-ylethyl)-9,9-dimethylfluorene |
| SMILES | CC(c1ccc2c(c1)C=C=C2)c1ccc2c(c1)C(C)(C)c1ccccc1-2.CC1(C)c2ccccc2-c2ccc(N)cc21.NN |
| InChI | InChI=1S/C26H22.C15H15N.H4N2/c1-17(19-12-11-18-7-6-8-21(18)15-19)20-13-14-23-22-9-4-5-10-24(22)26(2,3)25(23)16-20;1-15(2)13-6-4-3-5-11(13)12-8-7-10(16)9-14(12)15;1-2/h4-5,7-17H,1-3H3;3-9H,16H2,1-2H3;1-2H2 |
| InChIKey | JTUGTLUVTMNNEH-UHFFFAOYSA-N |
| XLogP | 9.18 |
| TPSA | 78.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.80 |
| LogP ≤ 5 | 9.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|