C19H20O4 — CID 171878709
4-(9,9-dimethylfluoren-2-yl)-3,4-dihydroxybutanoic acid (PubChem CID 171878709) has the molecular formula C19H20O4 and a molecular weight of 312.37 g/mol. Its IUPAC name is 4-(9,9-dimethylfluoren-2-yl)-3,4-dihydroxybutanoic acid.
| Compound Name | 4-(9,9-dimethylfluoren-2-yl)-3,4-dihydroxybutanoic acid |
|---|---|
| PubChem CID | 171878709 |
| Molecular Formula | C19H20O4 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | 4-(9,9-dimethylfluoren-2-yl)-3,4-dihydroxybutanoic acid |
| SMILES | CC1(C)c2ccccc2-c2ccc(C(O)C(O)CC(=O)O)cc21 |
| InChI | InChI=1S/C19H20O4/c1-19(2)14-6-4-3-5-12(14)13-8-7-11(9-15(13)19)18(23)16(20)10-17(21)22/h3-9,16,18,20,23H,10H2,1-2H3,(H,21,22) |
| InChIKey | GXDXXYYQKGYDBK-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |