C49H42O — CID 58922078
bis(6,6,12,12-tetramethylindeno[1,2-b]fluoren-2-yl)methanone (PubChem CID 58922078) has the molecular formula C49H42O and a molecular weight of 646.87 g/mol. Its IUPAC name is bis(6,6,12,12-tetramethylindeno[1,2-b]fluoren-2-yl)methanone.
| Compound Name | bis(6,6,12,12-tetramethylindeno[1,2-b]fluoren-2-yl)methanone |
|---|---|
| PubChem CID | 58922078 |
| Molecular Formula | C49H42O |
| Molecular Weight | 646.87 g/mol |
| Exact Mass | 646.32 |
| IUPAC Name | bis(6,6,12,12-tetramethylindeno[1,2-b]fluoren-2-yl)methanone |
| SMILES | CC1(C)c2ccccc2-c2cc3c(cc21)-c1ccc(C(=O)c2ccc4c(c2)C(C)(C)c2cc5c(cc2-4)C(C)(C)c2ccccc2-5)cc1C3(C)C |
| InChI | InChI=1S/C49H42O/c1-46(2)37-15-11-9-13-29(37)33-23-43-35(25-41(33)46)31-19-17-27(21-39(31)48(43,5)6)45(50)28-18-20-32-36-26-42-34(24-44(36)49(7,8)40(32)22-28)30-14-10-12-16-38(30)47(42,3)4/h9-26H,1-8H3 |
| InChIKey | OCOOPODCYBUMFO-UHFFFAOYSA-N |
| XLogP | 12.14 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.87 |
| LogP ≤ 5 | 12.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |