C22H21I — CID 89161500
2-[(1E,3E,5Z)-1-iodohepta-1,3,5-trien-4-yl]-9,9-dimethylfluorene (PubChem CID 89161500) has the molecular formula C22H21I and a molecular weight of 412.31 g/mol. Its IUPAC name is 2-[(1E,3E,5Z)-1-iodohepta-1,3,5-trien-4-yl]-9,9-dimethylfluorene.
| Compound Name | 2-[(1E,3E,5Z)-1-iodohepta-1,3,5-trien-4-yl]-9,9-dimethylfluorene |
|---|---|
| PubChem CID | 89161500 |
| Molecular Formula | C22H21I |
| Molecular Weight | 412.31 g/mol |
| Exact Mass | 412.07 |
| IUPAC Name | 2-[(1E,3E,5Z)-1-iodohepta-1,3,5-trien-4-yl]-9,9-dimethylfluorene |
| SMILES | C/C=C\C(=C/C=C/I)c1ccc2c(c1)C(C)(C)c1ccccc1-2 |
| InChI | InChI=1S/C22H21I/c1-4-8-16(9-7-14-23)17-12-13-19-18-10-5-6-11-20(18)22(2,3)21(19)15-17/h4-15H,1-3H3/b8-4-,14-7+,16-9+ |
| InChIKey | ZQJUTABRVIBJFM-VIGNWWOZSA-N |
| XLogP | 6.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.31 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|