C35H42 — CID 123187844
2,7-ditert-butyl-4-(2-hexa-2,4-dien-3-ylphenyl)-9,9-dimethylfluorene (PubChem CID 123187844) has the molecular formula C35H42 and a molecular weight of 462.72 g/mol. Its IUPAC name is 2,7-ditert-butyl-4-(2-hexa-2,4-dien-3-ylphenyl)-9,9-dimethylfluorene.
| Compound Name | 2,7-ditert-butyl-4-(2-hexa-2,4-dien-3-ylphenyl)-9,9-dimethylfluorene |
|---|---|
| PubChem CID | 123187844 |
| Molecular Formula | C35H42 |
| Molecular Weight | 462.72 g/mol |
| Exact Mass | 462.33 |
| IUPAC Name | 2,7-ditert-butyl-4-(2-hexa-2,4-dien-3-ylphenyl)-9,9-dimethylfluorene |
| SMILES | CC=CC(=CC)c1ccccc1-c1cc(C(C)(C)C)cc2c1-c1ccc(C(C)(C)C)cc1C2(C)C |
| InChI | InChI=1S/C35H42/c1-11-15-23(12-2)26-16-13-14-17-27(26)29-20-25(34(6,7)8)22-31-32(29)28-19-18-24(33(3,4)5)21-30(28)35(31,9)10/h11-22H,1-10H3 |
| InChIKey | CYRAUZBJVXKMNR-UHFFFAOYSA-N |
| XLogP | 10.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.72 |
| LogP ≤ 5 | 10.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|