C23H30 — CID 140861200
2,4-ditert-butyl-9,9-dimethylfluorene (PubChem CID 140861200) has the molecular formula C23H30 and a molecular weight of 306.49 g/mol. Its IUPAC name is 2,4-ditert-butyl-9,9-dimethylfluorene.
| Compound Name | 2,4-ditert-butyl-9,9-dimethylfluorene |
|---|---|
| PubChem CID | 140861200 |
| Molecular Formula | C23H30 |
| Molecular Weight | 306.49 g/mol |
| Exact Mass | 306.23 |
| IUPAC Name | 2,4-ditert-butyl-9,9-dimethylfluorene |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)c2c(c1)C(C)(C)c1ccccc1-2 |
| InChI | InChI=1S/C23H30/c1-21(2,3)15-13-18(22(4,5)6)20-16-11-9-10-12-17(16)23(7,8)19(20)14-15/h9-14H,1-8H3 |
| InChIKey | BCIDEXXTPPGEBM-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.49 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |