C61H71N — CID 176605468
6,8-ditert-butyl-N-(6,8-ditert-butyl-9,9-dimethylfluoren-2-yl)-N-(9,9-dimethylfluoren-2-yl)-9,9-dimethylfluoren-4-amine (PubChem CID 176605468) has the molecular formula C61H71N and a molecular weight of 818.25 g/mol. Its IUPAC name is 6,8-ditert-butyl-N-(6,8-ditert-butyl-9,9-dimethylfluoren-2-yl)-N-(9,9-dimethylfluoren-2-yl)-9,9-dimethylfluoren-4-amine.
| Compound Name | 6,8-ditert-butyl-N-(6,8-ditert-butyl-9,9-dimethylfluoren-2-yl)-N-(9,9-dimethylfluoren-2-yl)-9,9-dimethylfluoren-4-amine |
|---|---|
| PubChem CID | 176605468 |
| Molecular Formula | C61H71N |
| Molecular Weight | 818.25 g/mol |
| Exact Mass | 817.56 |
| IUPAC Name | 6,8-ditert-butyl-N-(6,8-ditert-butyl-9,9-dimethylfluoren-2-yl)-N-(9,9-dimethylfluoren-2-yl)-9,9-dimethylfluoren-4-amine |
| SMILES | CC(C)(C)c1cc2c(c(C(C)(C)C)c1)C(C)(C)c1cc(N(c3ccc4c(c3)C(C)(C)c3ccccc3-4)c3cccc4c3-c3cc(C(C)(C)C)cc(C(C)(C)C)c3C4(C)C)ccc1-2 |
| InChI | InChI=1S/C61H71N/c1-55(2,3)36-30-43-42-29-27-39(35-48(42)61(17,18)53(43)49(32-36)57(7,8)9)62(38-26-28-41-40-22-19-20-23-45(40)59(13,14)47(41)34-38)51-25-21-24-46-52(51)44-31-37(56(4,5)6)33-50(58(10,11)12)54(44)60(46,15)16/h19-35H,1-18H3 |
| InChIKey | JBQYQKPFYNAECC-UHFFFAOYSA-N |
| XLogP | 17.27 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 818.25 |
| LogP ≤ 5 | 17.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |